C13H19ClN4O2 — CID 17066612
N-(5-chloro-2-pyridinyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]acetamide (PubChem CID 17066612) has the molecular formula C13H19ClN4O2 and a molecular weight of 298.77 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 17066612 |
| Molecular Formula | C13H19ClN4O2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[4-(2-hydroxyethyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(CCO)CC1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H19ClN4O2/c14-11-1-2-12(15-9-11)16-13(20)10-18-5-3-17(4-6-18)7-8-19/h1-2,9,19H,3-8,10H2,(H,15,16,20) |
| InChIKey | PVDNFFGRWUHAHR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |