C12H17ClN4O3S — CID 17376167
N-(5-chloro-2-pyridinyl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide (PubChem CID 17376167) has the molecular formula C12H17ClN4O3S and a molecular weight of 332.81 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 17376167 |
| Molecular Formula | C12H17ClN4O3S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
| SMILES | CS(=O)(=O)N1CCN(CC(=O)Nc2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C12H17ClN4O3S/c1-21(19,20)17-6-4-16(5-7-17)9-12(18)15-11-3-2-10(13)8-14-11/h2-3,8H,4-7,9H2,1H3,(H,14,15,18) |
| InChIKey | ZSYWJAADTHXGDG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |