C13H19ClN4O3S — CID 31872788
(2S)-N-(5-chloro-2-pyridinyl)-2-(4-methylsulfonylpiperazin-1-yl)propanamide (PubChem CID 31872788) has the molecular formula C13H19ClN4O3S and a molecular weight of 346.84 g/mol. Its IUPAC name is (2S)-N-(5-chloro-2-pyridinyl)-2-(4-methylsulfonylpiperazin-1-yl)propanamide.
| Compound Name | (2S)-N-(5-chloro-2-pyridinyl)-2-(4-methylsulfonylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 31872788 |
| Molecular Formula | C13H19ClN4O3S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (2S)-N-(5-chloro-2-pyridinyl)-2-(4-methylsulfonylpiperazin-1-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(Cl)cn1)N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H19ClN4O3S/c1-10(13(19)16-12-4-3-11(14)9-15-12)17-5-7-18(8-6-17)22(2,20)21/h3-4,9-10H,5-8H2,1-2H3,(H,15,16,19)/t10-/m0/s1 |
| InChIKey | UOHBDXXJJSFCJT-JTQLQIEISA-N |
| XLogP | 0.64 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |