C17H21ClN4OS — CID 30956228
(2R)-N-(5-chloro-2-pyridinyl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propanamide (PubChem CID 30956228) has the molecular formula C17H21ClN4OS and a molecular weight of 364.90 g/mol. Its IUPAC name is (2R)-N-(5-chloro-2-pyridinyl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-(5-chloro-2-pyridinyl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 30956228 |
| Molecular Formula | C17H21ClN4OS |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2R)-N-(5-chloro-2-pyridinyl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(Cl)cn1)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C17H21ClN4OS/c1-13(17(23)20-16-5-4-14(18)11-19-16)22-8-6-21(7-9-22)12-15-3-2-10-24-15/h2-5,10-11,13H,6-9,12H2,1H3,(H,19,20,23)/t13-/m1/s1 |
| InChIKey | KXOFXBLAQJZXBK-CYBMUJFWSA-N |
| XLogP | 2.94 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |