C22H25N3OS — CID 8720791
(2R)-N-naphthalen-2-yl-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propanamide (PubChem CID 8720791) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is (2R)-N-naphthalen-2-yl-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-naphthalen-2-yl-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 8720791 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (2R)-N-naphthalen-2-yl-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc2ccccc2c1)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C22H25N3OS/c1-17(25-12-10-24(11-13-25)16-21-7-4-14-27-21)22(26)23-20-9-8-18-5-2-3-6-19(18)15-20/h2-9,14-15,17H,10-13,16H2,1H3,(H,23,26)/t17-/m1/s1 |
| InChIKey | PXQGCSCCDVKCMS-QGZVFWFLSA-N |
| XLogP | 4.05 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |