C13H17ClFN3O — CID 164584586
(2S)-N-(5-chloro-2-pyridinyl)-2-(4-fluoropiperidin-1-yl)propanamide (PubChem CID 164584586) has the molecular formula C13H17ClFN3O and a molecular weight of 285.75 g/mol. Its IUPAC name is (2S)-N-(5-chloro-2-pyridinyl)-2-(4-fluoropiperidin-1-yl)propanamide.
| Compound Name | (2S)-N-(5-chloro-2-pyridinyl)-2-(4-fluoropiperidin-1-yl)propanamide |
|---|---|
| PubChem CID | 164584586 |
| Molecular Formula | C13H17ClFN3O |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (2S)-N-(5-chloro-2-pyridinyl)-2-(4-fluoropiperidin-1-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(Cl)cn1)N1CCC(F)CC1 |
| InChI | InChI=1S/C13H17ClFN3O/c1-9(18-6-4-11(15)5-7-18)13(19)17-12-3-2-10(14)8-16-12/h2-3,8-9,11H,4-7H2,1H3,(H,16,17,19)/t9-/m0/s1 |
| InChIKey | DTAXPGKPEZQBMP-VIFPVBQESA-N |
| XLogP | 2.50 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |