C13H13ClN2O2S — CID 123589003
S-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-ethenylbut-2-enethioate (PubChem CID 123589003) has the molecular formula C13H13ClN2O2S and a molecular weight of 296.78 g/mol. Its IUPAC name is S-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-ethenylbut-2-enethioate.
| Compound Name | S-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-ethenylbut-2-enethioate |
|---|---|
| PubChem CID | 123589003 |
| Molecular Formula | C13H13ClN2O2S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | S-[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-ethenylbut-2-enethioate |
| SMILES | C=CC(=CC)C(=O)SCC(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H13ClN2O2S/c1-3-9(4-2)13(18)19-8-12(17)16-11-6-5-10(14)7-15-11/h3-7H,1,8H2,2H3,(H,15,16,17) |
| InChIKey | SISFSESOFLMFAR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|