C7H7ClN2O5S2 — CID 141094479
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanyl hydrogen sulfate (PubChem CID 141094479) has the molecular formula C7H7ClN2O5S2 and a molecular weight of 298.73 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanyl hydrogen sulfate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanyl hydrogen sulfate |
|---|---|
| PubChem CID | 141094479 |
| Molecular Formula | C7H7ClN2O5S2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 297.95 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl]sulfanyl hydrogen sulfate |
| SMILES | O=C(CSOS(=O)(=O)O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C7H7ClN2O5S2/c8-5-1-2-6(9-3-5)10-7(11)4-16-15-17(12,13)14/h1-3H,4H2,(H,9,10,11)(H,12,13,14) |
| InChIKey | OUCDMJMQWGKWAS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|