C17H25N3OS2 — CID 9456668
[2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-methylpiperazine-1-carbodithioate (PubChem CID 9456668) has the molecular formula C17H25N3OS2 and a molecular weight of 351.54 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-methylpiperazine-1-carbodithioate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-methylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 9456668 |
| Molecular Formula | C17H25N3OS2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 4-methylpiperazine-1-carbodithioate |
| SMILES | Cc1cc(C)c(NC(=O)CSC(=S)N2CCN(C)CC2)c(C)c1 |
| InChI | InChI=1S/C17H25N3OS2/c1-12-9-13(2)16(14(3)10-12)18-15(21)11-23-17(22)20-7-5-19(4)6-8-20/h9-10H,5-8,11H2,1-4H3,(H,18,21) |
| InChIKey | ATOLDERJSAVIAJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|