C13H20N4OS2 — CID 7705397
[2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] pyrrolidine-1-carbodithioate (PubChem CID 7705397) has the molecular formula C13H20N4OS2 and a molecular weight of 312.46 g/mol. Its IUPAC name is [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7705397 |
| Molecular Formula | C13H20N4OS2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [2-oxo-2-[(1,3,5-trimethylpyrazol-4-yl)amino]ethyl] pyrrolidine-1-carbodithioate |
| SMILES | Cc1nn(C)c(C)c1NC(=O)CSC(=S)N1CCCC1 |
| InChI | InChI=1S/C13H20N4OS2/c1-9-12(10(2)16(3)15-9)14-11(18)8-20-13(19)17-6-4-5-7-17/h4-8H2,1-3H3,(H,14,18) |
| InChIKey | LKMTVXCXDFKFHQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|