C19H29N3O3S2 — CID 155807489
[2-(2,6-dimethylanilino)-2-oxoethyl] 4-[2-(2-hydroxyethoxy)ethyl]piperazine-1-carbodithioate (PubChem CID 155807489) has the molecular formula C19H29N3O3S2 and a molecular weight of 411.59 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[2-(2-hydroxyethoxy)ethyl]piperazine-1-carbodithioate.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[2-(2-hydroxyethoxy)ethyl]piperazine-1-carbodithioate |
|---|---|
| PubChem CID | 155807489 |
| Molecular Formula | C19H29N3O3S2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl] 4-[2-(2-hydroxyethoxy)ethyl]piperazine-1-carbodithioate |
| SMILES | Cc1cccc(C)c1NC(=O)CSC(=S)N1CCN(CCOCCO)CC1 |
| InChI | InChI=1S/C19H29N3O3S2/c1-15-4-3-5-16(2)18(15)20-17(24)14-27-19(26)22-8-6-21(7-9-22)10-12-25-13-11-23/h3-5,23H,6-14H2,1-2H3,(H,20,24) |
| InChIKey | ZMPIZLMOGYDPBR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|