C15H22N2OS2 — CID 54064674
(4-hydroxy-3,5-dimethylphenyl)methyl 4-methylpiperazine-1-carbodithioate (PubChem CID 54064674) has the molecular formula C15H22N2OS2 and a molecular weight of 310.49 g/mol. Its IUPAC name is (4-hydroxy-3,5-dimethylphenyl)methyl 4-methylpiperazine-1-carbodithioate.
| Compound Name | (4-hydroxy-3,5-dimethylphenyl)methyl 4-methylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 54064674 |
| Molecular Formula | C15H22N2OS2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (4-hydroxy-3,5-dimethylphenyl)methyl 4-methylpiperazine-1-carbodithioate |
| SMILES | Cc1cc(CSC(=S)N2CCN(C)CC2)cc(C)c1O |
| InChI | InChI=1S/C15H22N2OS2/c1-11-8-13(9-12(2)14(11)18)10-20-15(19)17-6-4-16(3)5-7-17/h8-9,18H,4-7,10H2,1-3H3 |
| InChIKey | MCDAUVKTEQUMJM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|