C8H14N2O2S2 — CID 792683
2-(4-methylpiperazine-1-carbothioyl)sulfanylacetic acid (PubChem CID 792683) has the molecular formula C8H14N2O2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is 2-(4-methylpiperazine-1-carbothioyl)sulfanylacetic acid.
| Compound Name | 2-(4-methylpiperazine-1-carbothioyl)sulfanylacetic acid |
|---|---|
| PubChem CID | 792683 |
| Molecular Formula | C8H14N2O2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-(4-methylpiperazine-1-carbothioyl)sulfanylacetic acid |
| SMILES | CN1CCN(C(=S)SCC(=O)O)CC1 |
| InChI | InChI=1S/C8H14N2O2S2/c1-9-2-4-10(5-3-9)8(13)14-6-7(11)12/h2-6H2,1H3,(H,11,12) |
| InChIKey | DKQJANRYSFHQKR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|