C13H19N3O2S2 — CID 9458143
[2-(furan-2-ylmethylamino)-2-oxoethyl] 4-methylpiperazine-1-carbodithioate (PubChem CID 9458143) has the molecular formula C13H19N3O2S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-methylpiperazine-1-carbodithioate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-methylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 9458143 |
| Molecular Formula | C13H19N3O2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 4-methylpiperazine-1-carbodithioate |
| SMILES | CN1CCN(C(=S)SCC(=O)NCc2ccco2)CC1 |
| InChI | InChI=1S/C13H19N3O2S2/c1-15-4-6-16(7-5-15)13(19)20-10-12(17)14-9-11-3-2-8-18-11/h2-3,8H,4-7,9-10H2,1H3,(H,14,17) |
| InChIKey | MCTKNVBLOXGPMK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|