C19H21N3O3S2 — CID 8694578
[2-[2-(furan-2-ylmethylcarbamoyl)anilino]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 8694578) has the molecular formula C19H21N3O3S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is [2-[2-(furan-2-ylmethylcarbamoyl)anilino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-[2-(furan-2-ylmethylcarbamoyl)anilino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 8694578 |
| Molecular Formula | C19H21N3O3S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | [2-[2-(furan-2-ylmethylcarbamoyl)anilino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCCC1)Nc1ccccc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C19H21N3O3S2/c23-17(13-27-19(26)22-9-3-4-10-22)21-16-8-2-1-7-15(16)18(24)20-12-14-6-5-11-25-14/h1-2,5-8,11H,3-4,9-10,12-13H2,(H,20,24)(H,21,23) |
| InChIKey | NVTIRPGXVMUUEC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|