C13H20N2O2 — CID 110688280
N-(furan-2-ylmethyl)-3-piperidin-1-ylpropanamide (PubChem CID 110688280) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-piperidin-1-ylpropanamide.
| Compound Name | N-(furan-2-ylmethyl)-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 110688280 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-piperidin-1-ylpropanamide |
| SMILES | O=C(CCN1CCCCC1)NCc1ccco1 |
| InChI | InChI=1S/C13H20N2O2/c16-13(14-11-12-5-4-10-17-12)6-9-15-7-2-1-3-8-15/h4-5,10H,1-3,6-9,11H2,(H,14,16) |
| InChIKey | KMPUQPKUIOKKSZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |