C15H24N2O4S — CID 110299780
N-(furan-2-ylmethyl)-5-piperidin-1-ylsulfonylpentanamide (PubChem CID 110299780) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-5-piperidin-1-ylsulfonylpentanamide.
| Compound Name | N-(furan-2-ylmethyl)-5-piperidin-1-ylsulfonylpentanamide |
|---|---|
| PubChem CID | 110299780 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-5-piperidin-1-ylsulfonylpentanamide |
| SMILES | O=C(CCCCS(=O)(=O)N1CCCCC1)NCc1ccco1 |
| InChI | InChI=1S/C15H24N2O4S/c18-15(16-13-14-7-6-11-21-14)8-2-5-12-22(19,20)17-9-3-1-4-10-17/h6-7,11H,1-5,8-10,12-13H2,(H,16,18) |
| InChIKey | WQCJFIOLDLEBIA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|