C8H11N3O2S — CID 60641878
[2-(furan-2-ylmethylamino)-2-oxoethyl] carbamimidothioate (PubChem CID 60641878) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] carbamimidothioate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] carbamimidothioate |
|---|---|
| PubChem CID | 60641878 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C8H11N3O2S/c9-8(10)14-5-7(12)11-4-6-2-1-3-13-6/h1-3H,4-5H2,(H3,9,10)(H,11,12) |
| InChIKey | GOOXJBCEZKPFRE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 92.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|