C15H18F3N3O2S2 — CID 99935291
[2-oxo-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl] (2S,6S)-2,6-dimethylmorpholine-4-carbodithioate (PubChem CID 99935291) has the molecular formula C15H18F3N3O2S2 and a molecular weight of 393.46 g/mol. Its IUPAC name is [2-oxo-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl] (2S,6S)-2,6-dimethylmorpholine-4-carbodithioate.
| Compound Name | [2-oxo-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl] (2S,6S)-2,6-dimethylmorpholine-4-carbodithioate |
|---|---|
| PubChem CID | 99935291 |
| Molecular Formula | C15H18F3N3O2S2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | [2-oxo-2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl] (2S,6S)-2,6-dimethylmorpholine-4-carbodithioate |
| SMILES | C[C@H]1CN(C(=S)SCC(=O)Nc2ccc(C(F)(F)F)cn2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H18F3N3O2S2/c1-9-6-21(7-10(2)23-9)14(24)25-8-13(22)20-12-4-3-11(5-19-12)15(16,17)18/h3-5,9-10H,6-8H2,1-2H3,(H,19,20,22)/t9-,10-/m0/s1 |
| InChIKey | ABYKDTAFBVIEOF-UWVGGRQHSA-N |
| XLogP | 3.17 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|