C21H29N3O4S2 — CID 87048353
[1-(phenylcarbamoyl)piperidin-4-yl] 2-(2,6-dimethylmorpholine-4-carbothioyl)sulfanylacetate (PubChem CID 87048353) has the molecular formula C21H29N3O4S2 and a molecular weight of 451.61 g/mol. Its IUPAC name is [1-(phenylcarbamoyl)piperidin-4-yl] 2-(2,6-dimethylmorpholine-4-carbothioyl)sulfanylacetate.
| Compound Name | [1-(phenylcarbamoyl)piperidin-4-yl] 2-(2,6-dimethylmorpholine-4-carbothioyl)sulfanylacetate |
|---|---|
| PubChem CID | 87048353 |
| Molecular Formula | C21H29N3O4S2 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | [1-(phenylcarbamoyl)piperidin-4-yl] 2-(2,6-dimethylmorpholine-4-carbothioyl)sulfanylacetate |
| SMILES | CC1CN(C(=S)SCC(=O)OC2CCN(C(=O)Nc3ccccc3)CC2)CC(C)O1 |
| InChI | InChI=1S/C21H29N3O4S2/c1-15-12-24(13-16(2)27-15)21(29)30-14-19(25)28-18-8-10-23(11-9-18)20(26)22-17-6-4-3-5-7-17/h3-7,15-16,18H,8-14H2,1-2H3,(H,22,26) |
| InChIKey | NFSXOVSBODRNFR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|