C16H18N4O2S3 — CID 2068424
[2-oxo-2-[(4-oxo-1,3-benzothiazin-2-yl)amino]ethyl] 4-methylpiperazine-1-carbodithioate (PubChem CID 2068424) has the molecular formula C16H18N4O2S3 and a molecular weight of 394.55 g/mol. Its IUPAC name is [2-oxo-2-[(4-oxo-1,3-benzothiazin-2-yl)amino]ethyl] 4-methylpiperazine-1-carbodithioate.
| Compound Name | [2-oxo-2-[(4-oxo-1,3-benzothiazin-2-yl)amino]ethyl] 4-methylpiperazine-1-carbodithioate |
|---|---|
| PubChem CID | 2068424 |
| Molecular Formula | C16H18N4O2S3 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | [2-oxo-2-[(4-oxo-1,3-benzothiazin-2-yl)amino]ethyl] 4-methylpiperazine-1-carbodithioate |
| SMILES | CN1CCN(C(=S)SCC(=O)Nc2nc(=O)c3ccccc3s2)CC1 |
| InChI | InChI=1S/C16H18N4O2S3/c1-19-6-8-20(9-7-19)16(23)24-10-13(21)17-15-18-14(22)11-4-2-3-5-12(11)25-15/h2-5H,6-10H2,1H3,(H,17,18,21,22) |
| InChIKey | BFTBCCDVFDSIOA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|