C15H21ClN3O2S2+ — CID 9423310
[2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 4-methylpiperazin-4-ium-1-carbodithioate (PubChem CID 9423310) has the molecular formula C15H21ClN3O2S2+ and a molecular weight of 374.94 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 4-methylpiperazin-4-ium-1-carbodithioate.
| Compound Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 4-methylpiperazin-4-ium-1-carbodithioate |
|---|---|
| PubChem CID | 9423310 |
| Molecular Formula | C15H21ClN3O2S2+ |
| Molecular Weight | 374.94 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 4-methylpiperazin-4-ium-1-carbodithioate |
| SMILES | COc1ccc(NC(=O)CSC(=S)N2CC[NH+](C)CC2)cc1Cl |
| InChI | InChI=1S/C15H20ClN3O2S2/c1-18-5-7-19(8-6-18)15(22)23-10-14(20)17-11-3-4-13(21-2)12(16)9-11/h3-4,9H,5-8,10H2,1-2H3,(H,17,20)/p+1 |
| InChIKey | SMSHWMDLCGTZHY-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.94 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|