C13H14Cl2N2O3 — CID 111798594
N-(3,4-dichlorophenyl)-2-[3-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoacetamide (PubChem CID 111798594) has the molecular formula C13H14Cl2N2O3 and a molecular weight of 317.17 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[3-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[3-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 111798594 |
| Molecular Formula | C13H14Cl2N2O3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[3-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoacetamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)C(=O)N1CCC(CO)C1 |
| InChI | InChI=1S/C13H14Cl2N2O3/c14-10-2-1-9(5-11(10)15)16-12(19)13(20)17-4-3-8(6-17)7-18/h1-2,5,8,18H,3-4,6-7H2,(H,16,19) |
| InChIKey | YBGAHRLNPMKYFE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|