C20H31N3O2S — CID 118771400
2-[3-(2-aminoethoxy)phenyl]-N-[1-(thian-4-yl)piperidin-4-yl]acetamide (PubChem CID 118771400) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is 2-[3-(2-aminoethoxy)phenyl]-N-[1-(thian-4-yl)piperidin-4-yl]acetamide.
| Compound Name | 2-[3-(2-aminoethoxy)phenyl]-N-[1-(thian-4-yl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 118771400 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-[3-(2-aminoethoxy)phenyl]-N-[1-(thian-4-yl)piperidin-4-yl]acetamide |
| SMILES | NCCOc1cccc(CC(=O)NC2CCN(C3CCSCC3)CC2)c1 |
| InChI | InChI=1S/C20H31N3O2S/c21-8-11-25-19-3-1-2-16(14-19)15-20(24)22-17-4-9-23(10-5-17)18-6-12-26-13-7-18/h1-3,14,17-18H,4-13,15,21H2,(H,22,24) |
| InChIKey | JCGUQJQJPMZYQR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |