C17H29N5O5S — CID 154910337
N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-4-(1,2,4-triazol-1-yl)butanamide;formic acid (PubChem CID 154910337) has the molecular formula C17H29N5O5S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-4-(1,2,4-triazol-1-yl)butanamide;formic acid.
| Compound Name | N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-4-(1,2,4-triazol-1-yl)butanamide;formic acid |
|---|---|
| PubChem CID | 154910337 |
| Molecular Formula | C17H29N5O5S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[1-(1,1-dioxothian-4-yl)piperidin-4-yl]-4-(1,2,4-triazol-1-yl)butanamide;formic acid |
| SMILES | O=C(CCCn1cncn1)NC1CCN(C2CCS(=O)(=O)CC2)CC1.O=CO |
| InChI | InChI=1S/C16H27N5O3S.CH2O2/c22-16(2-1-7-21-13-17-12-18-21)19-14-3-8-20(9-4-14)15-5-10-25(23,24)11-6-15;2-1-3/h12-15H,1-11H2,(H,19,22);1H,(H,2,3) |
| InChIKey | OSGDTSLMBVLOJP-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|