C17H18N4O4S2 — CID 167798179
5-(furan-2-yl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)-1H-pyrazole-3-carboxamide (PubChem CID 167798179) has the molecular formula C17H18N4O4S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167798179 |
| Molecular Formula | C17H18N4O4S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 5-(furan-2-yl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)-1H-pyrazole-3-carboxamide |
| SMILES | O=C(NC1CCN(S(=O)(=O)c2cccs2)CC1)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C17H18N4O4S2/c22-17(14-11-13(19-20-14)15-3-1-9-25-15)18-12-5-7-21(8-6-12)27(23,24)16-4-2-10-26-16/h1-4,9-12H,5-8H2,(H,18,22)(H,19,20) |
| InChIKey | SBVLZUZQRYLSPQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |