C17H17BrN2O6 — CID 108551489
N-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]-3,4,5-trihydroxybenzamide (PubChem CID 108551489) has the molecular formula C17H17BrN2O6 and a molecular weight of 425.24 g/mol. Its IUPAC name is N-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 108551489 |
| Molecular Formula | C17H17BrN2O6 |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | N-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]-3,4,5-trihydroxybenzamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccc(Br)o2)CC1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C17H17BrN2O6/c18-14-2-1-13(26-14)17(25)20-5-3-10(4-6-20)19-16(24)9-7-11(21)15(23)12(22)8-9/h1-2,7-8,10,21-23H,3-6H2,(H,19,24) |
| InChIKey | XAULBLGLKHKECZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|