C17H17BrN2O6 — CID 108545693
(5-bromofuran-2-yl)-[4-(3,4,5-trihydroxybenzoyl)-1,4-diazepan-1-yl]methanone (PubChem CID 108545693) has the molecular formula C17H17BrN2O6 and a molecular weight of 425.24 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-[4-(3,4,5-trihydroxybenzoyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (5-bromofuran-2-yl)-[4-(3,4,5-trihydroxybenzoyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 108545693 |
| Molecular Formula | C17H17BrN2O6 |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | (5-bromofuran-2-yl)-[4-(3,4,5-trihydroxybenzoyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1cc(O)c(O)c(O)c1)N1CCCN(C(=O)c2ccc(Br)o2)CC1 |
| InChI | InChI=1S/C17H17BrN2O6/c18-14-3-2-13(26-14)17(25)20-5-1-4-19(6-7-20)16(24)10-8-11(21)15(23)12(22)9-10/h2-3,8-9,21-23H,1,4-7H2 |
| InChIKey | ADYKGSVCCJLEJQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|