C17H15BrClFN2O3 — CID 108558645
N-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]-2-chloro-6-fluorobenzamide (PubChem CID 108558645) has the molecular formula C17H15BrClFN2O3 and a molecular weight of 429.67 g/mol. Its IUPAC name is N-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]-2-chloro-6-fluorobenzamide.
| Compound Name | N-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]-2-chloro-6-fluorobenzamide |
|---|---|
| PubChem CID | 108558645 |
| Molecular Formula | C17H15BrClFN2O3 |
| Molecular Weight | 429.67 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | N-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]-2-chloro-6-fluorobenzamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccc(Br)o2)CC1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C17H15BrClFN2O3/c18-14-5-4-13(25-14)17(24)22-8-6-10(7-9-22)21-16(23)15-11(19)2-1-3-12(15)20/h1-5,10H,6-9H2,(H,21,23) |
| InChIKey | BCBYGGSTONIVGY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |