C17H15BrCl2N2O3 — CID 108564551
N-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]-2,4-dichlorobenzamide (PubChem CID 108564551) has the molecular formula C17H15BrCl2N2O3 and a molecular weight of 446.13 g/mol. Its IUPAC name is N-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 108564551 |
| Molecular Formula | C17H15BrCl2N2O3 |
| Molecular Weight | 446.13 g/mol |
| Exact Mass | 443.96 |
| IUPAC Name | N-[1-(5-bromofuran-2-carbonyl)piperidin-4-yl]-2,4-dichlorobenzamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccc(Br)o2)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15BrCl2N2O3/c18-15-4-3-14(25-15)17(24)22-7-5-11(6-8-22)21-16(23)12-2-1-10(19)9-13(12)20/h1-4,9,11H,5-8H2,(H,21,23) |
| InChIKey | BZVNYPSTZGVOAE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.13 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |