C15H18BrNO3 — CID 115617105
methyl 4-[(3-bromobenzoyl)amino]cyclohexane-1-carboxylate (PubChem CID 115617105) has the molecular formula C15H18BrNO3 and a molecular weight of 340.22 g/mol. Its IUPAC name is methyl 4-[(3-bromobenzoyl)amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[(3-bromobenzoyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 115617105 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | methyl 4-[(3-bromobenzoyl)amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C15H18BrNO3/c1-20-15(19)10-5-7-13(8-6-10)17-14(18)11-3-2-4-12(16)9-11/h2-4,9-10,13H,5-8H2,1H3,(H,17,18) |
| InChIKey | PQPKXXSLDOXCRP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |