C15H18INO3 — CID 115617185
methyl 4-[(4-iodobenzoyl)amino]cyclohexane-1-carboxylate (PubChem CID 115617185) has the molecular formula C15H18INO3 and a molecular weight of 387.22 g/mol. Its IUPAC name is methyl 4-[(4-iodobenzoyl)amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[(4-iodobenzoyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 115617185 |
| Molecular Formula | C15H18INO3 |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | methyl 4-[(4-iodobenzoyl)amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)c2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C15H18INO3/c1-20-15(19)11-4-8-13(9-5-11)17-14(18)10-2-6-12(16)7-3-10/h2-3,6-7,11,13H,4-5,8-9H2,1H3,(H,17,18) |
| InChIKey | RZCWRSUBGVUSGT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|