C20H28N2O3 — CID 67844920
methyl 4-[(4-piperidin-4-ylbenzoyl)amino]cyclohexane-1-carboxylate (PubChem CID 67844920) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is methyl 4-[(4-piperidin-4-ylbenzoyl)amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[(4-piperidin-4-ylbenzoyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67844920 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | methyl 4-[(4-piperidin-4-ylbenzoyl)amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)c2ccc(C3CCNCC3)cc2)CC1 |
| InChI | InChI=1S/C20H28N2O3/c1-25-20(24)17-6-8-18(9-7-17)22-19(23)16-4-2-14(3-5-16)15-10-12-21-13-11-15/h2-5,15,17-18,21H,6-13H2,1H3,(H,22,23) |
| InChIKey | MYXCYEXVHBXLTM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |