C24H36N2O3 — CID 67844937
propan-2-yl 3-[4-[(4-piperidin-4-ylbenzoyl)amino]cyclohexyl]propanoate (PubChem CID 67844937) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is propan-2-yl 3-[4-[(4-piperidin-4-ylbenzoyl)amino]cyclohexyl]propanoate.
| Compound Name | propan-2-yl 3-[4-[(4-piperidin-4-ylbenzoyl)amino]cyclohexyl]propanoate |
|---|---|
| PubChem CID | 67844937 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | propan-2-yl 3-[4-[(4-piperidin-4-ylbenzoyl)amino]cyclohexyl]propanoate |
| SMILES | CC(C)OC(=O)CCC1CCC(NC(=O)c2ccc(C3CCNCC3)cc2)CC1 |
| InChI | InChI=1S/C24H36N2O3/c1-17(2)29-23(27)12-5-18-3-10-22(11-4-18)26-24(28)21-8-6-19(7-9-21)20-13-15-25-16-14-20/h6-9,17-18,20,22,25H,3-5,10-16H2,1-2H3,(H,26,28) |
| InChIKey | VBBYAFMCYXBRGU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |