C15H19F3N2O — CID 162554246
N-piperidin-4-yl-4-(1,1,1-trifluoropropan-2-yl)benzamide (PubChem CID 162554246) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is N-piperidin-4-yl-4-(1,1,1-trifluoropropan-2-yl)benzamide.
| Compound Name | N-piperidin-4-yl-4-(1,1,1-trifluoropropan-2-yl)benzamide |
|---|---|
| PubChem CID | 162554246 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-piperidin-4-yl-4-(1,1,1-trifluoropropan-2-yl)benzamide |
| SMILES | CC(c1ccc(C(=O)NC2CCNCC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O/c1-10(15(16,17)18)11-2-4-12(5-3-11)14(21)20-13-6-8-19-9-7-13/h2-5,10,13,19H,6-9H2,1H3,(H,20,21) |
| InChIKey | SBIKJIMREOUFHT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |