C21H29ClN2O3 — CID 67844587
3-[4-[(2-chloro-4-piperidin-4-ylbenzoyl)amino]cyclohexyl]propanoic acid (PubChem CID 67844587) has the molecular formula C21H29ClN2O3 and a molecular weight of 392.93 g/mol. Its IUPAC name is 3-[4-[(2-chloro-4-piperidin-4-ylbenzoyl)amino]cyclohexyl]propanoic acid.
| Compound Name | 3-[4-[(2-chloro-4-piperidin-4-ylbenzoyl)amino]cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 67844587 |
| Molecular Formula | C21H29ClN2O3 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 3-[4-[(2-chloro-4-piperidin-4-ylbenzoyl)amino]cyclohexyl]propanoic acid |
| SMILES | O=C(O)CCC1CCC(NC(=O)c2ccc(C3CCNCC3)cc2Cl)CC1 |
| InChI | InChI=1S/C21H29ClN2O3/c22-19-13-16(15-9-11-23-12-10-15)4-7-18(19)21(27)24-17-5-1-14(2-6-17)3-8-20(25)26/h4,7,13-15,17,23H,1-3,5-6,8-12H2,(H,24,27)(H,25,26) |
| InChIKey | UCLGDZYBMUBNPJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |