C17H23FN2O2 — CID 171361952
2-fluoro-N-(oxan-4-yl)-5-piperidin-4-ylbenzamide (PubChem CID 171361952) has the molecular formula C17H23FN2O2 and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-fluoro-N-(oxan-4-yl)-5-piperidin-4-ylbenzamide.
| Compound Name | 2-fluoro-N-(oxan-4-yl)-5-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 171361952 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-fluoro-N-(oxan-4-yl)-5-piperidin-4-ylbenzamide |
| SMILES | O=C(NC1CCOCC1)c1cc(C2CCNCC2)ccc1F |
| InChI | InChI=1S/C17H23FN2O2/c18-16-2-1-13(12-3-7-19-8-4-12)11-15(16)17(21)20-14-5-9-22-10-6-14/h1-2,11-12,14,19H,3-10H2,(H,20,21) |
| InChIKey | IGZLIIALDDQGNX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |