C22H34N2O2 — CID 67844695
3-[4-[methyl-[(4-piperidin-4-ylphenyl)methyl]amino]cyclohexyl]propanoic acid (PubChem CID 67844695) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 3-[4-[methyl-[(4-piperidin-4-ylphenyl)methyl]amino]cyclohexyl]propanoic acid.
| Compound Name | 3-[4-[methyl-[(4-piperidin-4-ylphenyl)methyl]amino]cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 67844695 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 3-[4-[methyl-[(4-piperidin-4-ylphenyl)methyl]amino]cyclohexyl]propanoic acid |
| SMILES | CN(Cc1ccc(C2CCNCC2)cc1)C1CCC(CCC(=O)O)CC1 |
| InChI | InChI=1S/C22H34N2O2/c1-24(21-9-4-17(5-10-21)6-11-22(25)26)16-18-2-7-19(8-3-18)20-12-14-23-15-13-20/h2-3,7-8,17,20-21,23H,4-6,9-16H2,1H3,(H,25,26) |
| InChIKey | WSDHLQPZKYHRJW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |