C21H31N3O3 — CID 67844674
2-amino-3-[4-[(4-piperidin-4-ylbenzoyl)amino]cyclohexyl]propanoic acid (PubChem CID 67844674) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-amino-3-[4-[(4-piperidin-4-ylbenzoyl)amino]cyclohexyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[(4-piperidin-4-ylbenzoyl)amino]cyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 67844674 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 2-amino-3-[4-[(4-piperidin-4-ylbenzoyl)amino]cyclohexyl]propanoic acid |
| SMILES | NC(CC1CCC(NC(=O)c2ccc(C3CCNCC3)cc2)CC1)C(=O)O |
| InChI | InChI=1S/C21H31N3O3/c22-19(21(26)27)13-14-1-7-18(8-2-14)24-20(25)17-5-3-15(4-6-17)16-9-11-23-12-10-16/h3-6,14,16,18-19,23H,1-2,7-13,22H2,(H,24,25)(H,26,27) |
| InChIKey | YDWJCBKPYHOUOQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |