C14H17BrN2O3 — CID 115669882
methyl 4-[(6-bromopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate (PubChem CID 115669882) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.21 g/mol. Its IUPAC name is methyl 4-[(6-bromopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[(6-bromopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 115669882 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | methyl 4-[(6-bromopyridine-3-carbonyl)amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)c2ccc(Br)nc2)CC1 |
| InChI | InChI=1S/C14H17BrN2O3/c1-20-14(19)9-2-5-11(6-3-9)17-13(18)10-4-7-12(15)16-8-10/h4,7-9,11H,2-3,5-6H2,1H3,(H,17,18) |
| InChIKey | WSCKSRGGURKVDB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|