C14H19BrN2O — CID 66463063
6-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-carboxamide (PubChem CID 66463063) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is 6-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66463063 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 6-bromo-N-(2,3-dimethylcyclohexyl)pyridine-3-carboxamide |
| SMILES | CC1CCCC(NC(=O)c2ccc(Br)nc2)C1C |
| InChI | InChI=1S/C14H19BrN2O/c1-9-4-3-5-12(10(9)2)17-14(18)11-6-7-13(15)16-8-11/h6-10,12H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | IEXOOYWQDVMCIV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|