C27H31N2O+ — CID 7348933
1-(4-benzhydrylpiperazin-4-ium-1-yl)-4-phenylbutan-1-one (PubChem CID 7348933) has the molecular formula C27H31N2O+ and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-4-ium-1-yl)-4-phenylbutan-1-one.
| Compound Name | 1-(4-benzhydrylpiperazin-4-ium-1-yl)-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 7348933 |
| Molecular Formula | C27H31N2O+ |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-4-ium-1-yl)-4-phenylbutan-1-one |
| SMILES | O=C(CCCc1ccccc1)N1CC[NH+](C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H30N2O/c30-26(18-10-13-23-11-4-1-5-12-23)28-19-21-29(22-20-28)27(24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-9,11-12,14-17,27H,10,13,18-22H2/p+1 |
| InChIKey | GWLXFMGMUXNVRN-UHFFFAOYSA-O |
| XLogP | 3.53 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |