C20H22N2O3 — CID 2051404
3-(4-benzhydrylpiperazin-4-ium-1-yl)-3-oxopropanoate (PubChem CID 2051404) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-(4-benzhydrylpiperazin-4-ium-1-yl)-3-oxopropanoate.
| Compound Name | 3-(4-benzhydrylpiperazin-4-ium-1-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 2051404 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3-(4-benzhydrylpiperazin-4-ium-1-yl)-3-oxopropanoate |
| SMILES | O=C([O-])CC(=O)N1CC[NH+](C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H22N2O3/c23-18(15-19(24)25)21-11-13-22(14-12-21)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,20H,11-15H2,(H,24,25) |
| InChIKey | HCXLYQRDCTYRHX-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 64.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|