C28H32N3O3+ — CID 2456788
(3aS,7aR)-2-[3-(4-benzhydrylpiperazin-4-ium-1-yl)-3-oxopropyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 2456788) has the molecular formula C28H32N3O3+ and a molecular weight of 458.58 g/mol. Its IUPAC name is (3aS,7aR)-2-[3-(4-benzhydrylpiperazin-4-ium-1-yl)-3-oxopropyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-2-[3-(4-benzhydrylpiperazin-4-ium-1-yl)-3-oxopropyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2456788 |
| Molecular Formula | C28H32N3O3+ |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (3aS,7aR)-2-[3-(4-benzhydrylpiperazin-4-ium-1-yl)-3-oxopropyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C(CCN1C(=O)[C@H]2CC=CC[C@H]2C1=O)N1CC[NH+](C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H31N3O3/c32-25(15-16-31-27(33)23-13-7-8-14-24(23)28(31)34)29-17-19-30(20-18-29)26(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-12,23-24,26H,13-20H2/p+1/t23-,24+ |
| InChIKey | KUIVDPOJMMUWSD-PSWAGMNNSA-O |
| XLogP | 1.84 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|