C25H34N3O3+ — CID 7646734
methyl (2S,3S)-2-[(4-benzhydrylpiperazin-4-ium-1-carbonyl)amino]-3-methylpentanoate (PubChem CID 7646734) has the molecular formula C25H34N3O3+ and a molecular weight of 424.57 g/mol. Its IUPAC name is methyl (2S,3S)-2-[(4-benzhydrylpiperazin-4-ium-1-carbonyl)amino]-3-methylpentanoate.
| Compound Name | methyl (2S,3S)-2-[(4-benzhydrylpiperazin-4-ium-1-carbonyl)amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 7646734 |
| Molecular Formula | C25H34N3O3+ |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | methyl (2S,3S)-2-[(4-benzhydrylpiperazin-4-ium-1-carbonyl)amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)N1CC[NH+](C(c2ccccc2)c2ccccc2)CC1)C(=O)OC |
| InChI | InChI=1S/C25H33N3O3/c1-4-19(2)22(24(29)31-3)26-25(30)28-17-15-27(16-18-28)23(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,22-23H,4,15-18H2,1-3H3,(H,26,30)/p+1/t19-,22-/m0/s1 |
| InChIKey | POHILCHOFCRIBO-UGKGYDQZSA-O |
| XLogP | 2.27 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |