C27H38N4O2 — CID 133269505
4-benzhydryl-N-[(2R)-3-methyl-1-oxo-1-(propylamino)pentan-2-yl]piperazine-1-carboxamide (PubChem CID 133269505) has the molecular formula C27H38N4O2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 4-benzhydryl-N-[(2R)-3-methyl-1-oxo-1-(propylamino)pentan-2-yl]piperazine-1-carboxamide.
| Compound Name | 4-benzhydryl-N-[(2R)-3-methyl-1-oxo-1-(propylamino)pentan-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 133269505 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 4-benzhydryl-N-[(2R)-3-methyl-1-oxo-1-(propylamino)pentan-2-yl]piperazine-1-carboxamide |
| SMILES | CCCNC(=O)[C@H](NC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)C(C)CC |
| InChI | InChI=1S/C27H38N4O2/c1-4-16-28-26(32)24(21(3)5-2)29-27(33)31-19-17-30(18-20-31)25(22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,21,24-25H,4-5,16-20H2,1-3H3,(H,28,32)(H,29,33)/t21?,24-/m1/s1 |
| InChIKey | HQTKJGYITDVCFF-MQNHUJCZSA-N |
| XLogP | 4.04 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |