C30H42N4O2 — CID 23388414
N-[1-(4-benzhydrylpiperazin-1-yl)-4-methyl-1-oxopentan-2-yl]azepane-1-carboxamide (PubChem CID 23388414) has the molecular formula C30H42N4O2 and a molecular weight of 490.69 g/mol. Its IUPAC name is N-[1-(4-benzhydrylpiperazin-1-yl)-4-methyl-1-oxopentan-2-yl]azepane-1-carboxamide.
| Compound Name | N-[1-(4-benzhydrylpiperazin-1-yl)-4-methyl-1-oxopentan-2-yl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 23388414 |
| Molecular Formula | C30H42N4O2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | N-[1-(4-benzhydrylpiperazin-1-yl)-4-methyl-1-oxopentan-2-yl]azepane-1-carboxamide |
| SMILES | CC(C)CC(NC(=O)N1CCCCCC1)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H42N4O2/c1-24(2)23-27(31-30(36)34-17-11-3-4-12-18-34)29(35)33-21-19-32(20-22-33)28(25-13-7-5-8-14-25)26-15-9-6-10-16-26/h5-10,13-16,24,27-28H,3-4,11-12,17-23H2,1-2H3,(H,31,36) |
| InChIKey | GXYVKDPZINYJQP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |