C27H37N3O2 — CID 42698664
N-[1-(4-benzhydrylpiperazin-1-yl)-1-oxopentan-2-yl]-3-methylbutanamide (PubChem CID 42698664) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is N-[1-(4-benzhydrylpiperazin-1-yl)-1-oxopentan-2-yl]-3-methylbutanamide.
| Compound Name | N-[1-(4-benzhydrylpiperazin-1-yl)-1-oxopentan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 42698664 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | N-[1-(4-benzhydrylpiperazin-1-yl)-1-oxopentan-2-yl]-3-methylbutanamide |
| SMILES | CCCC(NC(=O)CC(C)C)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H37N3O2/c1-4-11-24(28-25(31)20-21(2)3)27(32)30-18-16-29(17-19-30)26(22-12-7-5-8-13-22)23-14-9-6-10-15-23/h5-10,12-15,21,24,26H,4,11,16-20H2,1-3H3,(H,28,31) |
| InChIKey | AORCPPRWNSOTQW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |