C30H36N4O3 — CID 42698495
1-[1-(4-benzhydrylpiperazin-1-yl)-1-oxopentan-2-yl]-3-(4-methoxyphenyl)urea (PubChem CID 42698495) has the molecular formula C30H36N4O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is 1-[1-(4-benzhydrylpiperazin-1-yl)-1-oxopentan-2-yl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[1-(4-benzhydrylpiperazin-1-yl)-1-oxopentan-2-yl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 42698495 |
| Molecular Formula | C30H36N4O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 1-[1-(4-benzhydrylpiperazin-1-yl)-1-oxopentan-2-yl]-3-(4-methoxyphenyl)urea |
| SMILES | CCCC(NC(=O)Nc1ccc(OC)cc1)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H36N4O3/c1-3-10-27(32-30(36)31-25-15-17-26(37-2)18-16-25)29(35)34-21-19-33(20-22-34)28(23-11-6-4-7-12-23)24-13-8-5-9-14-24/h4-9,11-18,27-28H,3,10,19-22H2,1-2H3,(H2,31,32,36) |
| InChIKey | ZUCJCUFXKCSMTK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |