C27H29N2O+ — CID 6962398
(4-benzhydrylpiperazin-4-ium-1-yl)-[(1S,2R)-2-phenylcyclopropyl]methanone (PubChem CID 6962398) has the molecular formula C27H29N2O+ and a molecular weight of 397.54 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-4-ium-1-yl)-[(1S,2R)-2-phenylcyclopropyl]methanone.
| Compound Name | (4-benzhydrylpiperazin-4-ium-1-yl)-[(1S,2R)-2-phenylcyclopropyl]methanone |
|---|---|
| PubChem CID | 6962398 |
| Molecular Formula | C27H29N2O+ |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | (4-benzhydrylpiperazin-4-ium-1-yl)-[(1S,2R)-2-phenylcyclopropyl]methanone |
| SMILES | O=C([C@H]1C[C@H]1c1ccccc1)N1CC[NH+](C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H28N2O/c30-27(25-20-24(25)21-10-4-1-5-11-21)29-18-16-28(17-19-29)26(22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-15,24-26H,16-20H2/p+1/t24-,25-/m0/s1 |
| InChIKey | XHQJYSCHUQBXDN-DQEYMECFSA-O |
| XLogP | 3.31 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |